C27H29F6N3O4 — CID 118109790
(2S,4R)-N-[2-fluoro-6-[4-[[1-(2,2,3,3,3-pentafluoropropyl)piperidin-4-yl]methoxy]phenyl]benzoyl]-4-hydroxypyrrolidine-2-carboxamide (PubChem CID 118109790) has the molecular formula C27H29F6N3O4 and a molecular weight of 573.53 g/mol. Its IUPAC name is (2S,4R)-N-[2-fluoro-6-[4-[[1-(2,2,3,3,3-pentafluoropropyl)piperidin-4-yl]methoxy]phenyl]benzoyl]-4-hydroxypyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-N-[2-fluoro-6-[4-[[1-(2,2,3,3,3-pentafluoropropyl)piperidin-4-yl]methoxy]phenyl]benzoyl]-4-hydroxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 118109790 |
| Molecular Formula | C27H29F6N3O4 |
| Molecular Weight | 573.53 g/mol |
| Exact Mass | 573.21 |
| IUPAC Name | (2S,4R)-N-[2-fluoro-6-[4-[[1-(2,2,3,3,3-pentafluoropropyl)piperidin-4-yl]methoxy]phenyl]benzoyl]-4-hydroxypyrrolidine-2-carboxamide |
| SMILES | O=C(NC(=O)[C@@H]1C[C@@H](O)CN1)c1c(F)cccc1-c1ccc(OCC2CCN(CC(F)(F)C(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C27H29F6N3O4/c28-21-3-1-2-20(23(21)25(39)35-24(38)22-12-18(37)13-34-22)17-4-6-19(7-5-17)40-14-16-8-10-36(11-9-16)15-26(29,30)27(31,32)33/h1-7,16,18,22,34,37H,8-15H2,(H,35,38,39)/t18-,22+/m1/s1 |
| InChIKey | CVANQPUJNFICRO-GCJKJVERSA-N |
| XLogP | 3.76 |
| TPSA | 90.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.53 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|