C26H28F6N4O4 — CID 118109935
(2S,4R)-1-[3-fluoro-4-[5-[[1-(2,2,3,3,3-pentafluoropropyl)piperidin-4-yl]methoxy]-2-pyridinyl]benzoyl]-4-hydroxypyrrolidine-2-carboxamide (PubChem CID 118109935) has the molecular formula C26H28F6N4O4 and a molecular weight of 574.52 g/mol. Its IUPAC name is (2S,4R)-1-[3-fluoro-4-[5-[[1-(2,2,3,3,3-pentafluoropropyl)piperidin-4-yl]methoxy]-2-pyridinyl]benzoyl]-4-hydroxypyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-1-[3-fluoro-4-[5-[[1-(2,2,3,3,3-pentafluoropropyl)piperidin-4-yl]methoxy]-2-pyridinyl]benzoyl]-4-hydroxypyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 118109935 |
| Molecular Formula | C26H28F6N4O4 |
| Molecular Weight | 574.52 g/mol |
| Exact Mass | 574.20 |
| IUPAC Name | (2S,4R)-1-[3-fluoro-4-[5-[[1-(2,2,3,3,3-pentafluoropropyl)piperidin-4-yl]methoxy]-2-pyridinyl]benzoyl]-4-hydroxypyrrolidine-2-carboxamide |
| SMILES | NC(=O)[C@@H]1C[C@@H](O)CN1C(=O)c1ccc(-c2ccc(OCC3CCN(CC(F)(F)C(F)(F)F)CC3)cn2)c(F)c1 |
| InChI | InChI=1S/C26H28F6N4O4/c27-20-9-16(24(39)36-12-17(37)10-22(36)23(33)38)1-3-19(20)21-4-2-18(11-34-21)40-13-15-5-7-35(8-6-15)14-25(28,29)26(30,31)32/h1-4,9,11,15,17,22,37H,5-8,10,12-14H2,(H2,33,38)/t17-,22+/m1/s1 |
| InChIKey | OFRWTSDWAANLDL-VGSWGCGISA-N |
| XLogP | 3.24 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.52 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|