C6H4Cl3F9Si — CID 11811026
trichloro(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silane (PubChem CID 11811026) has the molecular formula C6H4Cl3F9Si and a molecular weight of 381.53 g/mol. Its IUPAC name is trichloro(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silane.
| Compound Name | trichloro(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silane |
|---|---|
| PubChem CID | 11811026 |
| Molecular Formula | C6H4Cl3F9Si |
| Molecular Weight | 381.53 g/mol |
| Exact Mass | 379.90 |
| IUPAC Name | trichloro(3,3,4,4,5,5,6,6,6-nonafluorohexyl)silane |
| SMILES | FC(F)(F)C(F)(F)C(F)(F)C(F)(F)CC[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C6H4Cl3F9Si/c7-19(8,9)2-1-3(10,11)4(12,13)5(14,15)6(16,17)18/h1-2H2 |
| InChIKey | ZCVOUFBEEYGNOL-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.53 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|