About (NE,S)-N-[1-(3,5-dichlorophenyl)ethylidene]-2-methylpropane-2-sulfinamide
(NE,S)-N-[1-(3,5-dichlorophenyl)ethylidene]-2-methylpropane-2-sulfinamide (PubChem CID 118110610) has the molecular formula C12H15Cl2NOS
and a molecular weight of 292.23 g/mol. Its IUPAC name is (NE,S)-N-[1-(3,5-dichlorophenyl)ethylidene]-2-methylpropane-2-sulfinamide.
Molecular Properties
| Compound Name | (NE,S)-N-[1-(3,5-dichlorophenyl)ethylidene]-2-methylpropane-2-sulfinamide |
| PubChem CID | 118110610 |
| Molecular Formula | C12H15Cl2NOS |
| Molecular Weight | 292.23 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | (NE,S)-N-[1-(3,5-dichlorophenyl)ethylidene]-2-methylpropane-2-sulfinamide |
| SMILES | C/C(=N\[S@@](=O)C(C)(C)C)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C12H15Cl2NOS/c1-8(15-17(16)12(2,3)4)9-5-10(13)7-11(14)6-9/h5-7H,1-4H3/b15-8+/t17-/m0/s1 |
| InChIKey | VYJPJMZWOCGPNK-BXUGYJKXSA-N |
| XLogP | 4.26 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.23 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (NE,S)-N-[1-(3,5-dichlorophenyl)ethylidene]-2-methylpropane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE,S)-N-[1-(3,5-dichlorophenyl)ethylidene]-2-methylpropane-2-sulfinamide?
The IUPAC name of (NE,S)-N-[1-(3,5-dichlorophenyl)ethylidene]-2-methylpropane-2-sulfinamide (CID 118110610) is (NE,S)-N-[1-(3,5-dichlorophenyl)ethylidene]-2-methylpropane-2-sulfinamide.
What is the SMILES notation for (NE,S)-N-[1-(3,5-dichlorophenyl)ethylidene]-2-methylpropane-2-sulfinamide?
The canonical SMILES for (NE,S)-N-[1-(3,5-dichlorophenyl)ethylidene]-2-methylpropane-2-sulfinamide is C/C(=N\[S@@](=O)C(C)(C)C)c1cc(Cl)cc(Cl)c1.
What is the InChIKey of (NE,S)-N-[1-(3,5-dichlorophenyl)ethylidene]-2-methylpropane-2-sulfinamide?
The InChIKey is VYJPJMZWOCGPNK-BXUGYJKXSA-N. The full InChI is InChI=1S/C12H15Cl2NOS/c1-8(15-17(16)12(2,3)4)9-5-10(13)7-11(14)6-9/h5-7H,1-4H3/b15-8+/t17-/m0/s1.
What are the key properties of (NE,S)-N-[1-(3,5-dichlorophenyl)ethylidene]-2-methylpropane-2-sulfinamide?
(NE,S)-N-[1-(3,5-dichlorophenyl)ethylidene]-2-methylpropane-2-sulfinamide has a molecular weight of 292.23 g/mol, XLogP of 4.26, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (NE,S)-N-[1-(3,5-dichlorophenyl)ethylidene]-2-methylpropane-2-sulfinamide is sourced from PubChem (CID 118110610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).