C14H12BrF3N6 — CID 118111902
2-[(E)-2-[4-bromo-1-(2,2,2-trifluoroethyl)imidazol-2-yl]ethenyl]-5,8-dimethyl-[1,2,4]triazolo[1,5-c]pyrimidine (PubChem CID 118111902) has the molecular formula C14H12BrF3N6 and a molecular weight of 401.19 g/mol. Its IUPAC name is 2-[(E)-2-[4-bromo-1-(2,2,2-trifluoroethyl)imidazol-2-yl]ethenyl]-5,8-dimethyl-[1,2,4]triazolo[1,5-c]pyrimidine.
| Compound Name | 2-[(E)-2-[4-bromo-1-(2,2,2-trifluoroethyl)imidazol-2-yl]ethenyl]-5,8-dimethyl-[1,2,4]triazolo[1,5-c]pyrimidine |
|---|---|
| PubChem CID | 118111902 |
| Molecular Formula | C14H12BrF3N6 |
| Molecular Weight | 401.19 g/mol |
| Exact Mass | 400.03 |
| IUPAC Name | 2-[(E)-2-[4-bromo-1-(2,2,2-trifluoroethyl)imidazol-2-yl]ethenyl]-5,8-dimethyl-[1,2,4]triazolo[1,5-c]pyrimidine |
| SMILES | Cc1cnc(C)n2nc(/C=C/c3nc(Br)cn3CC(F)(F)F)nc12 |
| InChI | InChI=1S/C14H12BrF3N6/c1-8-5-19-9(2)24-13(8)21-11(22-24)3-4-12-20-10(15)6-23(12)7-14(16,17)18/h3-6H,7H2,1-2H3/b4-3+ |
| InChIKey | IVRRNSADJGPHPN-ONEGZZNKSA-N |
| XLogP | 3.43 |
| TPSA | 60.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.19 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |