About bis(ethene-1,1,2,2-tetramine);hydrochloride
bis(ethene-1,1,2,2-tetramine);hydrochloride (PubChem CID 118112492) has the molecular formula C4H17ClN8
and a molecular weight of 212.69 g/mol. Its IUPAC name is bis(ethene-1,1,2,2-tetramine);hydrochloride.
Molecular Properties
| Compound Name | bis(ethene-1,1,2,2-tetramine);hydrochloride |
| PubChem CID | 118112492 |
| Molecular Formula | C4H17ClN8 |
| Molecular Weight | 212.69 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | bis(ethene-1,1,2,2-tetramine);hydrochloride |
| SMILES | Cl.NC(N)=C(N)N.NC(N)=C(N)N |
| InChI | InChI=1S/2C2H8N4.ClH/c2*3-1(4)2(5)6;/h2*3-6H2;1H |
| InChIKey | VPRNUUOJMXADCH-UHFFFAOYSA-N |
| XLogP | -3.68 |
| TPSA | 208.16 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 212.69 |
| LogP ≤ 5 | -3.68 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze bis(ethene-1,1,2,2-tetramine);hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(ethene-1,1,2,2-tetramine);hydrochloride?
The IUPAC name of bis(ethene-1,1,2,2-tetramine);hydrochloride (CID 118112492) is bis(ethene-1,1,2,2-tetramine);hydrochloride.
What is the SMILES notation for bis(ethene-1,1,2,2-tetramine);hydrochloride?
The canonical SMILES for bis(ethene-1,1,2,2-tetramine);hydrochloride is Cl.NC(N)=C(N)N.NC(N)=C(N)N.
What is the InChIKey of bis(ethene-1,1,2,2-tetramine);hydrochloride?
The InChIKey is VPRNUUOJMXADCH-UHFFFAOYSA-N. The full InChI is InChI=1S/2C2H8N4.ClH/c2*3-1(4)2(5)6;/h2*3-6H2;1H.
What are the key properties of bis(ethene-1,1,2,2-tetramine);hydrochloride?
bis(ethene-1,1,2,2-tetramine);hydrochloride has a molecular weight of 212.69 g/mol, XLogP of -3.68, 0 rotatable bonds, 8 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for bis(ethene-1,1,2,2-tetramine);hydrochloride is sourced from PubChem (CID 118112492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).