C16H14F5N3O3S — CID 118113337
3-ethylsulfonyl-N-methyl-N-[5-(1,1,2,2,2-pentafluoroethyl)-2-pyridinyl]pyridine-2-carboxamide (PubChem CID 118113337) has the molecular formula C16H14F5N3O3S and a molecular weight of 423.36 g/mol. Its IUPAC name is 3-ethylsulfonyl-N-methyl-N-[5-(1,1,2,2,2-pentafluoroethyl)-2-pyridinyl]pyridine-2-carboxamide.
| Compound Name | 3-ethylsulfonyl-N-methyl-N-[5-(1,1,2,2,2-pentafluoroethyl)-2-pyridinyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 118113337 |
| Molecular Formula | C16H14F5N3O3S |
| Molecular Weight | 423.36 g/mol |
| Exact Mass | 423.07 |
| IUPAC Name | 3-ethylsulfonyl-N-methyl-N-[5-(1,1,2,2,2-pentafluoroethyl)-2-pyridinyl]pyridine-2-carboxamide |
| SMILES | CCS(=O)(=O)c1cccnc1C(=O)N(C)c1ccc(C(F)(F)C(F)(F)F)cn1 |
| InChI | InChI=1S/C16H14F5N3O3S/c1-3-28(26,27)11-5-4-8-22-13(11)14(25)24(2)12-7-6-10(9-23-12)15(17,18)16(19,20)21/h4-9H,3H2,1-2H3 |
| InChIKey | QELLCJMZRYDJLF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 80.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.36 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|