About 2-(4-bromophenoxy)-5-(1,3-dioxolan-2-yl)pyrazine
2-(4-bromophenoxy)-5-(1,3-dioxolan-2-yl)pyrazine (PubChem CID 118113438) has the molecular formula C13H11BrN2O3
and a molecular weight of 323.15 g/mol. Its IUPAC name is 2-(4-bromophenoxy)-5-(1,3-dioxolan-2-yl)pyrazine.
Molecular Properties
| Compound Name | 2-(4-bromophenoxy)-5-(1,3-dioxolan-2-yl)pyrazine |
| PubChem CID | 118113438 |
| Molecular Formula | C13H11BrN2O3 |
| Molecular Weight | 323.15 g/mol |
| Exact Mass | 322.00 |
| IUPAC Name | 2-(4-bromophenoxy)-5-(1,3-dioxolan-2-yl)pyrazine |
| SMILES | Brc1ccc(Oc2cnc(C3OCCO3)cn2)cc1 |
| InChI | InChI=1S/C13H11BrN2O3/c14-9-1-3-10(4-2-9)19-12-8-15-11(7-16-12)13-17-5-6-18-13/h1-4,7-8,13H,5-6H2 |
| InChIKey | QBPQEMVXUDDMAI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 53.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.15 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-(4-bromophenoxy)-5-(1,3-dioxolan-2-yl)pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-bromophenoxy)-5-(1,3-dioxolan-2-yl)pyrazine?
The IUPAC name of 2-(4-bromophenoxy)-5-(1,3-dioxolan-2-yl)pyrazine (CID 118113438) is 2-(4-bromophenoxy)-5-(1,3-dioxolan-2-yl)pyrazine.
What is the SMILES notation for 2-(4-bromophenoxy)-5-(1,3-dioxolan-2-yl)pyrazine?
The canonical SMILES for 2-(4-bromophenoxy)-5-(1,3-dioxolan-2-yl)pyrazine is Brc1ccc(Oc2cnc(C3OCCO3)cn2)cc1.
What is the InChIKey of 2-(4-bromophenoxy)-5-(1,3-dioxolan-2-yl)pyrazine?
The InChIKey is QBPQEMVXUDDMAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11BrN2O3/c14-9-1-3-10(4-2-9)19-12-8-15-11(7-16-12)13-17-5-6-18-13/h1-4,7-8,13H,5-6H2.
What are the key properties of 2-(4-bromophenoxy)-5-(1,3-dioxolan-2-yl)pyrazine?
2-(4-bromophenoxy)-5-(1,3-dioxolan-2-yl)pyrazine has a molecular weight of 323.15 g/mol, XLogP of 3.08, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-bromophenoxy)-5-(1,3-dioxolan-2-yl)pyrazine is sourced from PubChem (CID 118113438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).