C23H27NO5 — CID 11811398
1-O-benzyl 2-O-methyl (2S,3aR,7S,7aS)-6-oxo-7-pent-4-enyl-3,3a,7,7a-tetrahydro-2H-indole-1,2-dicarboxylate (PubChem CID 11811398) has the molecular formula C23H27NO5 and a molecular weight of 397.47 g/mol. Its IUPAC name is 1-O-benzyl 2-O-methyl (2S,3aR,7S,7aS)-6-oxo-7-pent-4-enyl-3,3a,7,7a-tetrahydro-2H-indole-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-methyl (2S,3aR,7S,7aS)-6-oxo-7-pent-4-enyl-3,3a,7,7a-tetrahydro-2H-indole-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11811398 |
| Molecular Formula | C23H27NO5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.19 |
| IUPAC Name | 1-O-benzyl 2-O-methyl (2S,3aR,7S,7aS)-6-oxo-7-pent-4-enyl-3,3a,7,7a-tetrahydro-2H-indole-1,2-dicarboxylate |
| SMILES | C=CCCC[C@@H]1C(=O)C=C[C@H]2C[C@@H](C(=O)OC)N(C(=O)OCc3ccccc3)[C@H]12 |
| InChI | InChI=1S/C23H27NO5/c1-3-4-6-11-18-20(25)13-12-17-14-19(22(26)28-2)24(21(17)18)23(27)29-15-16-9-7-5-8-10-16/h3,5,7-10,12-13,17-19,21H,1,4,6,11,14-15H2,2H3/t17-,18+,19-,21-/m0/s1 |
| InChIKey | SLVQDOUVSBLHTP-JTJHWIPRSA-N |
| XLogP | 3.67 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|