C9H19N3O — CID 118114950
1,1-dimethyl-3-[(2R,3R)-2-methylpiperidin-3-yl]urea (PubChem CID 118114950) has the molecular formula C9H19N3O and a molecular weight of 185.27 g/mol. Its IUPAC name is 1,1-dimethyl-3-[(2R,3R)-2-methylpiperidin-3-yl]urea.
| Compound Name | 1,1-dimethyl-3-[(2R,3R)-2-methylpiperidin-3-yl]urea |
|---|---|
| PubChem CID | 118114950 |
| Molecular Formula | C9H19N3O |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | 1,1-dimethyl-3-[(2R,3R)-2-methylpiperidin-3-yl]urea |
| SMILES | C[C@H]1NCCC[C@H]1NC(=O)N(C)C |
| InChI | InChI=1S/C9H19N3O/c1-7-8(5-4-6-10-7)11-9(13)12(2)3/h7-8,10H,4-6H2,1-3H3,(H,11,13)/t7-,8-/m1/s1 |
| InChIKey | CAHRMHQMODVARK-HTQZYQBOSA-N |
| XLogP | 0.40 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |