About (4-tributylstannyl-1,3-thiazol-2-yl)methanol
(4-tributylstannyl-1,3-thiazol-2-yl)methanol (PubChem CID 11811539) has the molecular formula C16H31NOSSn
and a molecular weight of 404.21 g/mol. Its IUPAC name is (4-tributylstannyl-1,3-thiazol-2-yl)methanol.
Molecular Properties
| Compound Name | (4-tributylstannyl-1,3-thiazol-2-yl)methanol |
| PubChem CID | 11811539 |
| Molecular Formula | C16H31NOSSn |
| Molecular Weight | 404.21 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | (4-tributylstannyl-1,3-thiazol-2-yl)methanol |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1csc(CO)n1 |
| InChI | InChI=1S/C4H4NOS.3C4H9.Sn/c6-3-4-5-1-2-7-4;3*1-3-4-2;/h2,6H,3H2;3*1,3-4H2,2H3; |
| InChIKey | MRRNSZJYKHMKNG-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 404.21 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4-tributylstannyl-1,3-thiazol-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-tributylstannyl-1,3-thiazol-2-yl)methanol?
The IUPAC name of (4-tributylstannyl-1,3-thiazol-2-yl)methanol (CID 11811539) is (4-tributylstannyl-1,3-thiazol-2-yl)methanol.
What is the SMILES notation for (4-tributylstannyl-1,3-thiazol-2-yl)methanol?
The canonical SMILES for (4-tributylstannyl-1,3-thiazol-2-yl)methanol is CCCC[Sn](CCCC)(CCCC)c1csc(CO)n1.
What is the InChIKey of (4-tributylstannyl-1,3-thiazol-2-yl)methanol?
The InChIKey is MRRNSZJYKHMKNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4NOS.3C4H9.Sn/c6-3-4-5-1-2-7-4;3*1-3-4-2;/h2,6H,3H2;3*1,3-4H2,2H3;.
What are the key properties of (4-tributylstannyl-1,3-thiazol-2-yl)methanol?
(4-tributylstannyl-1,3-thiazol-2-yl)methanol has a molecular weight of 404.21 g/mol, XLogP of 4.69, 11 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-tributylstannyl-1,3-thiazol-2-yl)methanol is sourced from PubChem (CID 11811539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).