About 3-[(6,7-dimethoxy-1-propylisoquinolin-4-yl)methyl]-5-(trifluoromethyl)quinolin-6-ol
3-[(6,7-dimethoxy-1-propylisoquinolin-4-yl)methyl]-5-(trifluoromethyl)quinolin-6-ol (PubChem CID 118115584) has the molecular formula C25H23F3N2O3
and a molecular weight of 456.46 g/mol. Its IUPAC name is 3-[(6,7-dimethoxy-1-propylisoquinolin-4-yl)methyl]-5-(trifluoromethyl)quinolin-6-ol.
Molecular Properties
| Compound Name | 3-[(6,7-dimethoxy-1-propylisoquinolin-4-yl)methyl]-5-(trifluoromethyl)quinolin-6-ol |
| PubChem CID | 118115584 |
| Molecular Formula | C25H23F3N2O3 |
| Molecular Weight | 456.46 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 3-[(6,7-dimethoxy-1-propylisoquinolin-4-yl)methyl]-5-(trifluoromethyl)quinolin-6-ol |
| SMILES | CCCc1ncc(Cc2cnc3ccc(O)c(C(F)(F)F)c3c2)c2cc(OC)c(OC)cc12 |
| InChI | InChI=1S/C25H23F3N2O3/c1-4-5-19-17-11-23(33-3)22(32-2)10-16(17)15(13-30-19)8-14-9-18-20(29-12-14)6-7-21(31)24(18)25(26,27)28/h6-7,9-13,31H,4-5,8H2,1-3H3 |
| InChIKey | MWLFLDJUMFIHDC-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.46 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(6,7-dimethoxy-1-propylisoquinolin-4-yl)methyl]-5-(trifluoromethyl)quinolin-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(6,7-dimethoxy-1-propylisoquinolin-4-yl)methyl]-5-(trifluoromethyl)quinolin-6-ol?
The IUPAC name of 3-[(6,7-dimethoxy-1-propylisoquinolin-4-yl)methyl]-5-(trifluoromethyl)quinolin-6-ol (CID 118115584) is 3-[(6,7-dimethoxy-1-propylisoquinolin-4-yl)methyl]-5-(trifluoromethyl)quinolin-6-ol.
What is the SMILES notation for 3-[(6,7-dimethoxy-1-propylisoquinolin-4-yl)methyl]-5-(trifluoromethyl)quinolin-6-ol?
The canonical SMILES for 3-[(6,7-dimethoxy-1-propylisoquinolin-4-yl)methyl]-5-(trifluoromethyl)quinolin-6-ol is CCCc1ncc(Cc2cnc3ccc(O)c(C(F)(F)F)c3c2)c2cc(OC)c(OC)cc12.
What is the InChIKey of 3-[(6,7-dimethoxy-1-propylisoquinolin-4-yl)methyl]-5-(trifluoromethyl)quinolin-6-ol?
The InChIKey is MWLFLDJUMFIHDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23F3N2O3/c1-4-5-19-17-11-23(33-3)22(32-2)10-16(17)15(13-30-19)8-14-9-18-20(29-12-14)6-7-21(31)24(18)25(26,27)28/h6-7,9-13,31H,4-5,8H2,1-3H3.
What are the key properties of 3-[(6,7-dimethoxy-1-propylisoquinolin-4-yl)methyl]-5-(trifluoromethyl)quinolin-6-ol?
3-[(6,7-dimethoxy-1-propylisoquinolin-4-yl)methyl]-5-(trifluoromethyl)quinolin-6-ol has a molecular weight of 456.46 g/mol, XLogP of 6.07, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(6,7-dimethoxy-1-propylisoquinolin-4-yl)methyl]-5-(trifluoromethyl)quinolin-6-ol is sourced from PubChem (CID 118115584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).