C21H26F2N6O2 — CID 118115597
N-(2,2-difluorocyclohexyl)-2-[(1-prop-2-enoylpiperidin-4-yl)amino]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 118115597) has the molecular formula C21H26F2N6O2 and a molecular weight of 432.48 g/mol. Its IUPAC name is N-(2,2-difluorocyclohexyl)-2-[(1-prop-2-enoylpiperidin-4-yl)amino]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | N-(2,2-difluorocyclohexyl)-2-[(1-prop-2-enoylpiperidin-4-yl)amino]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 118115597 |
| Molecular Formula | C21H26F2N6O2 |
| Molecular Weight | 432.48 g/mol |
| Exact Mass | 432.21 |
| IUPAC Name | N-(2,2-difluorocyclohexyl)-2-[(1-prop-2-enoylpiperidin-4-yl)amino]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | C=CC(=O)N1CCC(Nc2cnc3[nH]cc(C(=O)NC4CCCCC4(F)F)c3n2)CC1 |
| InChI | InChI=1S/C21H26F2N6O2/c1-2-17(30)29-9-6-13(7-10-29)26-16-12-25-19-18(28-16)14(11-24-19)20(31)27-15-5-3-4-8-21(15,22)23/h2,11-13,15H,1,3-10H2,(H,24,25)(H,26,28)(H,27,31) |
| InChIKey | NMGZVVGZFXPQGU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.48 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|