C9H13F3N2O — CID 118115608
1-[(3aR,7aS)-2,3,3a,4,5,6,7,7a-octahydropyrrolo[2,3-c]pyridin-1-yl]-2,2,2-trifluoroethanone (PubChem CID 118115608) has the molecular formula C9H13F3N2O and a molecular weight of 222.21 g/mol. Its IUPAC name is 1-[(3aR,7aS)-2,3,3a,4,5,6,7,7a-octahydropyrrolo[2,3-c]pyridin-1-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[(3aR,7aS)-2,3,3a,4,5,6,7,7a-octahydropyrrolo[2,3-c]pyridin-1-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 118115608 |
| Molecular Formula | C9H13F3N2O |
| Molecular Weight | 222.21 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 1-[(3aR,7aS)-2,3,3a,4,5,6,7,7a-octahydropyrrolo[2,3-c]pyridin-1-yl]-2,2,2-trifluoroethanone |
| SMILES | O=C(N1CC[C@H]2CCNC[C@H]21)C(F)(F)F |
| InChI | InChI=1S/C9H13F3N2O/c10-9(11,12)8(15)14-4-2-6-1-3-13-5-7(6)14/h6-7,13H,1-5H2/t6-,7-/m1/s1 |
| InChIKey | ZMPHJDZWWJMRPN-RNFRBKRXSA-N |
| XLogP | 0.76 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.21 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |