About 3-[(2R,3R)-1-(6-chloro-5-cyanopyrazin-2-yl)-2-methylpiperidin-3-yl]-1,1-dimethylurea
3-[(2R,3R)-1-(6-chloro-5-cyanopyrazin-2-yl)-2-methylpiperidin-3-yl]-1,1-dimethylurea (PubChem CID 118115647) has the molecular formula C14H19ClN6O
and a molecular weight of 322.80 g/mol. Its IUPAC name is 3-[(2R,3R)-1-(6-chloro-5-cyanopyrazin-2-yl)-2-methylpiperidin-3-yl]-1,1-dimethylurea.
Molecular Properties
| Compound Name | 3-[(2R,3R)-1-(6-chloro-5-cyanopyrazin-2-yl)-2-methylpiperidin-3-yl]-1,1-dimethylurea |
| PubChem CID | 118115647 |
| Molecular Formula | C14H19ClN6O |
| Molecular Weight | 322.80 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | 3-[(2R,3R)-1-(6-chloro-5-cyanopyrazin-2-yl)-2-methylpiperidin-3-yl]-1,1-dimethylurea |
| SMILES | C[C@@H]1[C@H](NC(=O)N(C)C)CCCN1c1cnc(C#N)c(Cl)n1 |
| InChI | InChI=1S/C14H19ClN6O/c1-9-10(18-14(22)20(2)3)5-4-6-21(9)12-8-17-11(7-16)13(15)19-12/h8-10H,4-6H2,1-3H3,(H,18,22)/t9-,10-/m1/s1 |
| InChIKey | KEFGEDKSBLIMJW-NXEZZACHSA-N |
| XLogP | 1.63 |
| TPSA | 85.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.80 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[(2R,3R)-1-(6-chloro-5-cyanopyrazin-2-yl)-2-methylpiperidin-3-yl]-1,1-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2R,3R)-1-(6-chloro-5-cyanopyrazin-2-yl)-2-methylpiperidin-3-yl]-1,1-dimethylurea?
The IUPAC name of 3-[(2R,3R)-1-(6-chloro-5-cyanopyrazin-2-yl)-2-methylpiperidin-3-yl]-1,1-dimethylurea (CID 118115647) is 3-[(2R,3R)-1-(6-chloro-5-cyanopyrazin-2-yl)-2-methylpiperidin-3-yl]-1,1-dimethylurea.
What is the SMILES notation for 3-[(2R,3R)-1-(6-chloro-5-cyanopyrazin-2-yl)-2-methylpiperidin-3-yl]-1,1-dimethylurea?
The canonical SMILES for 3-[(2R,3R)-1-(6-chloro-5-cyanopyrazin-2-yl)-2-methylpiperidin-3-yl]-1,1-dimethylurea is C[C@@H]1[C@H](NC(=O)N(C)C)CCCN1c1cnc(C#N)c(Cl)n1.
What is the InChIKey of 3-[(2R,3R)-1-(6-chloro-5-cyanopyrazin-2-yl)-2-methylpiperidin-3-yl]-1,1-dimethylurea?
The InChIKey is KEFGEDKSBLIMJW-NXEZZACHSA-N. The full InChI is InChI=1S/C14H19ClN6O/c1-9-10(18-14(22)20(2)3)5-4-6-21(9)12-8-17-11(7-16)13(15)19-12/h8-10H,4-6H2,1-3H3,(H,18,22)/t9-,10-/m1/s1.
What are the key properties of 3-[(2R,3R)-1-(6-chloro-5-cyanopyrazin-2-yl)-2-methylpiperidin-3-yl]-1,1-dimethylurea?
3-[(2R,3R)-1-(6-chloro-5-cyanopyrazin-2-yl)-2-methylpiperidin-3-yl]-1,1-dimethylurea has a molecular weight of 322.80 g/mol, XLogP of 1.63, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2R,3R)-1-(6-chloro-5-cyanopyrazin-2-yl)-2-methylpiperidin-3-yl]-1,1-dimethylurea is sourced from PubChem (CID 118115647), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).