C17H18F3N5O — CID 118115651
1-[(3aS,7aS)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-6-yl]-2-(trifluoromethyl)prop-2-en-1-one (PubChem CID 118115651) has the molecular formula C17H18F3N5O and a molecular weight of 365.36 g/mol. Its IUPAC name is 1-[(3aS,7aS)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-6-yl]-2-(trifluoromethyl)prop-2-en-1-one.
| Compound Name | 1-[(3aS,7aS)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-6-yl]-2-(trifluoromethyl)prop-2-en-1-one |
|---|---|
| PubChem CID | 118115651 |
| Molecular Formula | C17H18F3N5O |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.15 |
| IUPAC Name | 1-[(3aS,7aS)-1-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridin-6-yl]-2-(trifluoromethyl)prop-2-en-1-one |
| SMILES | C=C(C(=O)N1CC[C@@H]2CCN(c3ncnc4[nH]ccc34)[C@@H]2C1)C(F)(F)F |
| InChI | InChI=1S/C17H18F3N5O/c1-10(17(18,19)20)16(26)24-6-3-11-4-7-25(13(11)8-24)15-12-2-5-21-14(12)22-9-23-15/h2,5,9,11,13H,1,3-4,6-8H2,(H,21,22,23)/t11-,13-/m1/s1 |
| InChIKey | ILKDKXFUMINCQT-DGCLKSJQSA-N |
| XLogP | 2.50 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|