C14H17N5O2 — CID 118115675
1-[(3S,5R)-3-hydroxy-5-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)piperidin-1-yl]prop-2-en-1-one (PubChem CID 118115675) has the molecular formula C14H17N5O2 and a molecular weight of 287.32 g/mol. Its IUPAC name is 1-[(3S,5R)-3-hydroxy-5-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3S,5R)-3-hydroxy-5-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 118115675 |
| Molecular Formula | C14H17N5O2 |
| Molecular Weight | 287.32 g/mol |
| Exact Mass | 287.14 |
| IUPAC Name | 1-[(3S,5R)-3-hydroxy-5-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C[C@@H](O)C[C@@H](Nc2ncnc3[nH]ccc23)C1 |
| InChI | InChI=1S/C14H17N5O2/c1-2-12(21)19-6-9(5-10(20)7-19)18-14-11-3-4-15-13(11)16-8-17-14/h2-4,8-10,20H,1,5-7H2,(H2,15,16,17,18)/t9-,10+/m1/s1 |
| InChIKey | LISBXKYLOHKRRT-ZJUUUORDSA-N |
| XLogP | 0.52 |
| TPSA | 94.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.32 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|