C16H21N5O2 — CID 118115774
1-[(3R,5R)-3-methoxy-5-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]prop-2-en-1-one (PubChem CID 118115774) has the molecular formula C16H21N5O2 and a molecular weight of 315.38 g/mol. Its IUPAC name is 1-[(3R,5R)-3-methoxy-5-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R,5R)-3-methoxy-5-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 118115774 |
| Molecular Formula | C16H21N5O2 |
| Molecular Weight | 315.38 g/mol |
| Exact Mass | 315.17 |
| IUPAC Name | 1-[(3R,5R)-3-methoxy-5-[methyl(7H-pyrrolo[2,3-d]pyrimidin-4-yl)amino]piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C[C@H](OC)C[C@@H](N(C)c2ncnc3[nH]ccc23)C1 |
| InChI | InChI=1S/C16H21N5O2/c1-4-14(22)21-8-11(7-12(9-21)23-3)20(2)16-13-5-6-17-15(13)18-10-19-16/h4-6,10-12H,1,7-9H2,2-3H3,(H,17,18,19)/t11-,12-/m1/s1 |
| InChIKey | VVDFKTLHEVZYIQ-VXGBXAGGSA-N |
| XLogP | 1.20 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.38 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|