C18H25N5O — CID 118115777
2-methyl-1-[(3R)-3-(5-methyl-2,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(12),8,10-trien-7-yl)piperidin-1-yl]prop-2-en-1-one (PubChem CID 118115777) has the molecular formula C18H25N5O and a molecular weight of 327.43 g/mol. Its IUPAC name is 2-methyl-1-[(3R)-3-(5-methyl-2,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(12),8,10-trien-7-yl)piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 2-methyl-1-[(3R)-3-(5-methyl-2,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(12),8,10-trien-7-yl)piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 118115777 |
| Molecular Formula | C18H25N5O |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | 2-methyl-1-[(3R)-3-(5-methyl-2,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(12),8,10-trien-7-yl)piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=C(C)C(=O)N1CCC[C@@H](N2CC(C)C3CNc4ncnc2c43)C1 |
| InChI | InChI=1S/C18H25N5O/c1-11(2)18(24)22-6-4-5-13(9-22)23-8-12(3)14-7-19-16-15(14)17(23)21-10-20-16/h10,12-14H,1,4-9H2,2-3H3,(H,19,20,21)/t12?,13-,14?/m1/s1 |
| InChIKey | SARVQYUTPONNIE-ROKHWSDSSA-N |
| XLogP | 2.01 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|