C16H19N5O2 — CID 118115823
1-[(4aR,8aS)-4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]prop-2-en-1-one (PubChem CID 118115823) has the molecular formula C16H19N5O2 and a molecular weight of 313.36 g/mol. Its IUPAC name is 1-[(4aR,8aS)-4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]prop-2-en-1-one.
| Compound Name | 1-[(4aR,8aS)-4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 118115823 |
| Molecular Formula | C16H19N5O2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 1-[(4aR,8aS)-4-(7H-pyrrolo[2,3-d]pyrimidin-4-yl)-3,4a,5,7,8,8a-hexahydro-2H-pyrido[4,3-b][1,4]oxazin-6-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CC[C@@H]2OCCN(c3ncnc4[nH]ccc34)[C@@H]2C1 |
| InChI | InChI=1S/C16H19N5O2/c1-2-14(22)20-6-4-13-12(9-20)21(7-8-23-13)16-11-3-5-17-15(11)18-10-19-16/h2-3,5,10,12-13H,1,4,6-9H2,(H,17,18,19)/t12-,13+/m1/s1 |
| InChIKey | DWXSRXYQVVRTMV-OLZOCXBDSA-N |
| XLogP | 0.95 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|