C20H25FN6O2 — CID 118115824
N-[(1S,3R)-3-fluorocyclopentyl]-2-[(1-prop-2-enoylpiperidin-4-yl)amino]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 118115824) has the molecular formula C20H25FN6O2 and a molecular weight of 400.46 g/mol. Its IUPAC name is N-[(1S,3R)-3-fluorocyclopentyl]-2-[(1-prop-2-enoylpiperidin-4-yl)amino]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | N-[(1S,3R)-3-fluorocyclopentyl]-2-[(1-prop-2-enoylpiperidin-4-yl)amino]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 118115824 |
| Molecular Formula | C20H25FN6O2 |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.20 |
| IUPAC Name | N-[(1S,3R)-3-fluorocyclopentyl]-2-[(1-prop-2-enoylpiperidin-4-yl)amino]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | C=CC(=O)N1CCC(Nc2cnc3[nH]cc(C(=O)N[C@H]4CC[C@@H](F)C4)c3n2)CC1 |
| InChI | InChI=1S/C20H25FN6O2/c1-2-17(28)27-7-5-13(6-8-27)24-16-11-23-19-18(26-16)15(10-22-19)20(29)25-14-4-3-12(21)9-14/h2,10-14H,1,3-9H2,(H,22,23)(H,24,26)(H,25,29)/t12-,14+/m1/s1 |
| InChIKey | ZVOKIWUKIGUYJS-OCCSQVGLSA-N |
| XLogP | 2.17 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|