About 1-[4-(5H-pyrrolo[2,3-b]pyrazin-2-ylamino)piperidin-1-yl]prop-2-en-1-one
1-[4-(5H-pyrrolo[2,3-b]pyrazin-2-ylamino)piperidin-1-yl]prop-2-en-1-one (PubChem CID 118115835) has the molecular formula C14H17N5O
and a molecular weight of 271.32 g/mol. Its IUPAC name is 1-[4-(5H-pyrrolo[2,3-b]pyrazin-2-ylamino)piperidin-1-yl]prop-2-en-1-one.
Molecular Properties
| Compound Name | 1-[4-(5H-pyrrolo[2,3-b]pyrazin-2-ylamino)piperidin-1-yl]prop-2-en-1-one |
| PubChem CID | 118115835 |
| Molecular Formula | C14H17N5O |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 1-[4-(5H-pyrrolo[2,3-b]pyrazin-2-ylamino)piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1CCC(Nc2cnc3[nH]ccc3n2)CC1 |
| InChI | InChI=1S/C14H17N5O/c1-2-13(20)19-7-4-10(5-8-19)17-12-9-16-14-11(18-12)3-6-15-14/h2-3,6,9-10H,1,4-5,7-8H2,(H,15,16)(H,17,18) |
| InChIKey | UGEQKEXOZZZGSS-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-(5H-pyrrolo[2,3-b]pyrazin-2-ylamino)piperidin-1-yl]prop-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(5H-pyrrolo[2,3-b]pyrazin-2-ylamino)piperidin-1-yl]prop-2-en-1-one?
The IUPAC name of 1-[4-(5H-pyrrolo[2,3-b]pyrazin-2-ylamino)piperidin-1-yl]prop-2-en-1-one (CID 118115835) is 1-[4-(5H-pyrrolo[2,3-b]pyrazin-2-ylamino)piperidin-1-yl]prop-2-en-1-one.
What is the SMILES notation for 1-[4-(5H-pyrrolo[2,3-b]pyrazin-2-ylamino)piperidin-1-yl]prop-2-en-1-one?
The canonical SMILES for 1-[4-(5H-pyrrolo[2,3-b]pyrazin-2-ylamino)piperidin-1-yl]prop-2-en-1-one is C=CC(=O)N1CCC(Nc2cnc3[nH]ccc3n2)CC1.
What is the InChIKey of 1-[4-(5H-pyrrolo[2,3-b]pyrazin-2-ylamino)piperidin-1-yl]prop-2-en-1-one?
The InChIKey is UGEQKEXOZZZGSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N5O/c1-2-13(20)19-7-4-10(5-8-19)17-12-9-16-14-11(18-12)3-6-15-14/h2-3,6,9-10H,1,4-5,7-8H2,(H,15,16)(H,17,18).
What are the key properties of 1-[4-(5H-pyrrolo[2,3-b]pyrazin-2-ylamino)piperidin-1-yl]prop-2-en-1-one?
1-[4-(5H-pyrrolo[2,3-b]pyrazin-2-ylamino)piperidin-1-yl]prop-2-en-1-one has a molecular weight of 271.32 g/mol, XLogP of 1.55, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(5H-pyrrolo[2,3-b]pyrazin-2-ylamino)piperidin-1-yl]prop-2-en-1-one is sourced from PubChem (CID 118115835), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).