C17H22N6O2 — CID 118115839
N-propan-2-yl-2-[[3-(prop-2-enoylamino)cyclobutyl]amino]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 118115839) has the molecular formula C17H22N6O2 and a molecular weight of 342.40 g/mol. Its IUPAC name is N-propan-2-yl-2-[[3-(prop-2-enoylamino)cyclobutyl]amino]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | N-propan-2-yl-2-[[3-(prop-2-enoylamino)cyclobutyl]amino]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 118115839 |
| Molecular Formula | C17H22N6O2 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.18 |
| IUPAC Name | N-propan-2-yl-2-[[3-(prop-2-enoylamino)cyclobutyl]amino]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | C=CC(=O)NC1CC(Nc2cnc3[nH]cc(C(=O)NC(C)C)c3n2)C1 |
| InChI | InChI=1S/C17H22N6O2/c1-4-14(24)22-11-5-10(6-11)21-13-8-19-16-15(23-13)12(7-18-16)17(25)20-9(2)3/h4,7-11H,1,5-6H2,2-3H3,(H,18,19)(H,20,25)(H,21,23)(H,22,24) |
| InChIKey | MFKINBNCXDWIBB-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 111.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|