C18H23FN6O2 — CID 118115940
2-[[(3R,4R)-3-fluoro-1-prop-2-enoylpiperidin-4-yl]amino]-N-propan-2-yl-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 118115940) has the molecular formula C18H23FN6O2 and a molecular weight of 374.42 g/mol. Its IUPAC name is 2-[[(3R,4R)-3-fluoro-1-prop-2-enoylpiperidin-4-yl]amino]-N-propan-2-yl-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | 2-[[(3R,4R)-3-fluoro-1-prop-2-enoylpiperidin-4-yl]amino]-N-propan-2-yl-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 118115940 |
| Molecular Formula | C18H23FN6O2 |
| Molecular Weight | 374.42 g/mol |
| Exact Mass | 374.19 |
| IUPAC Name | 2-[[(3R,4R)-3-fluoro-1-prop-2-enoylpiperidin-4-yl]amino]-N-propan-2-yl-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | C=CC(=O)N1CC[C@@H](Nc2cnc3[nH]cc(C(=O)NC(C)C)c3n2)[C@H](F)C1 |
| InChI | InChI=1S/C18H23FN6O2/c1-4-15(26)25-6-5-13(12(19)9-25)23-14-8-21-17-16(24-14)11(7-20-17)18(27)22-10(2)3/h4,7-8,10,12-13H,1,5-6,9H2,2-3H3,(H,20,21)(H,22,27)(H,23,24)/t12-,13-/m1/s1 |
| InChIKey | QXVZCGKYISEKAR-CHWSQXEVSA-N |
| XLogP | 1.63 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.42 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|