C15H19N5O2 — CID 118115977
1-[(3R,5R)-3-methoxy-5-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)piperidin-1-yl]prop-2-en-1-one (PubChem CID 118115977) has the molecular formula C15H19N5O2 and a molecular weight of 301.35 g/mol. Its IUPAC name is 1-[(3R,5R)-3-methoxy-5-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)piperidin-1-yl]prop-2-en-1-one.
| Compound Name | 1-[(3R,5R)-3-methoxy-5-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 118115977 |
| Molecular Formula | C15H19N5O2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 1-[(3R,5R)-3-methoxy-5-(7H-pyrrolo[2,3-d]pyrimidin-4-ylamino)piperidin-1-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)N1C[C@H](Nc2ncnc3[nH]ccc23)C[C@@H](OC)C1 |
| InChI | InChI=1S/C15H19N5O2/c1-3-13(21)20-7-10(6-11(8-20)22-2)19-15-12-4-5-16-14(12)17-9-18-15/h3-5,9-11H,1,6-8H2,2H3,(H2,16,17,18,19)/t10-,11-/m1/s1 |
| InChIKey | QHOSFELSEJJWLJ-GHMZBOCLSA-N |
| XLogP | 1.17 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|