C20H24F2N6O2 — CID 118116046
N-(2,2-difluorocyclopentyl)-2-[(1-prop-2-enoylpiperidin-4-yl)amino]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 118116046) has the molecular formula C20H24F2N6O2 and a molecular weight of 418.45 g/mol. Its IUPAC name is N-(2,2-difluorocyclopentyl)-2-[(1-prop-2-enoylpiperidin-4-yl)amino]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | N-(2,2-difluorocyclopentyl)-2-[(1-prop-2-enoylpiperidin-4-yl)amino]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 118116046 |
| Molecular Formula | C20H24F2N6O2 |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.19 |
| IUPAC Name | N-(2,2-difluorocyclopentyl)-2-[(1-prop-2-enoylpiperidin-4-yl)amino]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | C=CC(=O)N1CCC(Nc2cnc3[nH]cc(C(=O)NC4CCCC4(F)F)c3n2)CC1 |
| InChI | InChI=1S/C20H24F2N6O2/c1-2-16(29)28-8-5-12(6-9-28)25-15-11-24-18-17(27-15)13(10-23-18)19(30)26-14-4-3-7-20(14,21)22/h2,10-12,14H,1,3-9H2,(H,23,24)(H,25,27)(H,26,30) |
| InChIKey | LHCSFZROJFNMFG-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|