C27H32N2O3S — CID 118116134
2-methyl-1-[3-(4-thiophen-2-yl-1H-indol-3-yl)butanoyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-5-carboxylic acid (PubChem CID 118116134) has the molecular formula C27H32N2O3S and a molecular weight of 464.63 g/mol. Its IUPAC name is 2-methyl-1-[3-(4-thiophen-2-yl-1H-indol-3-yl)butanoyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-5-carboxylic acid.
| Compound Name | 2-methyl-1-[3-(4-thiophen-2-yl-1H-indol-3-yl)butanoyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-5-carboxylic acid |
|---|---|
| PubChem CID | 118116134 |
| Molecular Formula | C27H32N2O3S |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 2-methyl-1-[3-(4-thiophen-2-yl-1H-indol-3-yl)butanoyl]-3,4,4a,5,6,7,8,8a-octahydro-2H-quinoline-5-carboxylic acid |
| SMILES | CC(CC(=O)N1C(C)CCC2C(C(=O)O)CCCC21)c1c[nH]c2cccc(-c3cccs3)c12 |
| InChI | InChI=1S/C27H32N2O3S/c1-16(21-15-28-22-8-3-7-20(26(21)22)24-10-5-13-33-24)14-25(30)29-17(2)11-12-18-19(27(31)32)6-4-9-23(18)29/h3,5,7-8,10,13,15-19,23,28H,4,6,9,11-12,14H2,1-2H3,(H,31,32) |
| InChIKey | UJSOLHZYILUSSX-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 73.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |