C21H27F3N6O3 — CID 118116162
2-[(1-prop-2-enoylpiperidin-4-yl)amino]-N-[(2R,3R)-1,1,1-trifluoro-2-hydroxy-4-methylpentan-3-yl]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide (PubChem CID 118116162) has the molecular formula C21H27F3N6O3 and a molecular weight of 468.48 g/mol. Its IUPAC name is 2-[(1-prop-2-enoylpiperidin-4-yl)amino]-N-[(2R,3R)-1,1,1-trifluoro-2-hydroxy-4-methylpentan-3-yl]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide.
| Compound Name | 2-[(1-prop-2-enoylpiperidin-4-yl)amino]-N-[(2R,3R)-1,1,1-trifluoro-2-hydroxy-4-methylpentan-3-yl]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 118116162 |
| Molecular Formula | C21H27F3N6O3 |
| Molecular Weight | 468.48 g/mol |
| Exact Mass | 468.21 |
| IUPAC Name | 2-[(1-prop-2-enoylpiperidin-4-yl)amino]-N-[(2R,3R)-1,1,1-trifluoro-2-hydroxy-4-methylpentan-3-yl]-5H-pyrrolo[2,3-b]pyrazine-7-carboxamide |
| SMILES | C=CC(=O)N1CCC(Nc2cnc3[nH]cc(C(=O)N[C@H](C(C)C)[C@@H](O)C(F)(F)F)c3n2)CC1 |
| InChI | InChI=1S/C21H27F3N6O3/c1-4-15(31)30-7-5-12(6-8-30)27-14-10-26-19-17(28-14)13(9-25-19)20(33)29-16(11(2)3)18(32)21(22,23)24/h4,9-12,16,18,32H,1,5-8H2,2-3H3,(H,25,26)(H,27,28)(H,29,33)/t16-,18-/m1/s1 |
| InChIKey | TUKIGDLGOFDVJU-SJLPKXTDSA-N |
| XLogP | 2.22 |
| TPSA | 123.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.48 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|