C19H27N5O2 — CID 118116209
tert-butyl 3-(5-methylidene-2,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(12),8,10-trien-7-yl)piperidine-1-carboxylate (PubChem CID 118116209) has the molecular formula C19H27N5O2 and a molecular weight of 357.46 g/mol. Its IUPAC name is tert-butyl 3-(5-methylidene-2,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(12),8,10-trien-7-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 3-(5-methylidene-2,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(12),8,10-trien-7-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118116209 |
| Molecular Formula | C19H27N5O2 |
| Molecular Weight | 357.46 g/mol |
| Exact Mass | 357.22 |
| IUPAC Name | tert-butyl 3-(5-methylidene-2,7,9,11-tetrazatricyclo[6.3.1.04,12]dodeca-1(12),8,10-trien-7-yl)piperidine-1-carboxylate |
| SMILES | C=C1CN(C2CCCN(C(=O)OC(C)(C)C)C2)c2ncnc3c2C1CN3 |
| InChI | InChI=1S/C19H27N5O2/c1-12-9-24(17-15-14(12)8-20-16(15)21-11-22-17)13-6-5-7-23(10-13)18(25)26-19(2,3)4/h11,13-14H,1,5-10H2,2-4H3,(H,20,21,22) |
| InChIKey | MOXLWSWHGNNDGT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|