C17H18FN5O2 — CID 118116228
1-[4-[[(3S,4R)-4-fluoro-1-prop-2-enoylpiperidin-3-yl]amino]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]prop-2-en-1-one (PubChem CID 118116228) has the molecular formula C17H18FN5O2 and a molecular weight of 343.36 g/mol. Its IUPAC name is 1-[4-[[(3S,4R)-4-fluoro-1-prop-2-enoylpiperidin-3-yl]amino]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]prop-2-en-1-one.
| Compound Name | 1-[4-[[(3S,4R)-4-fluoro-1-prop-2-enoylpiperidin-3-yl]amino]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 118116228 |
| Molecular Formula | C17H18FN5O2 |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 1-[4-[[(3S,4R)-4-fluoro-1-prop-2-enoylpiperidin-3-yl]amino]-7H-pyrrolo[2,3-d]pyrimidin-5-yl]prop-2-en-1-one |
| SMILES | C=CC(=O)c1c[nH]c2ncnc(N[C@H]3CN(C(=O)C=C)CC[C@H]3F)c12 |
| InChI | InChI=1S/C17H18FN5O2/c1-3-13(24)10-7-19-16-15(10)17(21-9-20-16)22-12-8-23(14(25)4-2)6-5-11(12)18/h3-4,7,9,11-12H,1-2,5-6,8H2,(H2,19,20,21,22)/t11-,12+/m1/s1 |
| InChIKey | NWXYDKXEEXZXEZ-NEPJUHHUSA-N |
| XLogP | 1.86 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|