C24H32N6O3S — CID 118116590
N-[1-[(1,1-dihydroxy-1,4-thiazinan-2-yl)-phenylmethyl]pyrazol-4-yl]-6,6-dimethyl-1,4,5,7-tetrahydroindazole-3-carboxamide (PubChem CID 118116590) has the molecular formula C24H32N6O3S and a molecular weight of 484.63 g/mol. Its IUPAC name is N-[1-[(1,1-dihydroxy-1,4-thiazinan-2-yl)-phenylmethyl]pyrazol-4-yl]-6,6-dimethyl-1,4,5,7-tetrahydroindazole-3-carboxamide.
| Compound Name | N-[1-[(1,1-dihydroxy-1,4-thiazinan-2-yl)-phenylmethyl]pyrazol-4-yl]-6,6-dimethyl-1,4,5,7-tetrahydroindazole-3-carboxamide |
|---|---|
| PubChem CID | 118116590 |
| Molecular Formula | C24H32N6O3S |
| Molecular Weight | 484.63 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | N-[1-[(1,1-dihydroxy-1,4-thiazinan-2-yl)-phenylmethyl]pyrazol-4-yl]-6,6-dimethyl-1,4,5,7-tetrahydroindazole-3-carboxamide |
| SMILES | CC1(C)CCc2c(C(=O)Nc3cnn(C(c4ccccc4)C4CNCCS4(O)O)c3)n[nH]c2C1 |
| InChI | InChI=1S/C24H32N6O3S/c1-24(2)9-8-18-19(12-24)28-29-21(18)23(31)27-17-13-26-30(15-17)22(16-6-4-3-5-7-16)20-14-25-10-11-34(20,32)33/h3-7,13,15,20,22,25,32-33H,8-12,14H2,1-2H3,(H,27,31)(H,28,29) |
| InChIKey | JBUYQSIXWQZSJK-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 128.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.63 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |