C21H34O6Si — CID 11811680
dimethyl (1S,2R,3S,7R)-7-but-3-enyl-3-[tert-butyl(dimethyl)silyl]oxy-6-oxocyclohept-4-ene-1,2-dicarboxylate (PubChem CID 11811680) has the molecular formula C21H34O6Si and a molecular weight of 410.58 g/mol. Its IUPAC name is dimethyl (1S,2R,3S,7R)-7-but-3-enyl-3-[tert-butyl(dimethyl)silyl]oxy-6-oxocyclohept-4-ene-1,2-dicarboxylate.
| Compound Name | dimethyl (1S,2R,3S,7R)-7-but-3-enyl-3-[tert-butyl(dimethyl)silyl]oxy-6-oxocyclohept-4-ene-1,2-dicarboxylate |
|---|---|
| PubChem CID | 11811680 |
| Molecular Formula | C21H34O6Si |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | dimethyl (1S,2R,3S,7R)-7-but-3-enyl-3-[tert-butyl(dimethyl)silyl]oxy-6-oxocyclohept-4-ene-1,2-dicarboxylate |
| SMILES | C=CCC[C@H]1C(=O)C=C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C(=O)OC)[C@H]1C(=O)OC |
| InChI | InChI=1S/C21H34O6Si/c1-9-10-11-14-15(22)12-13-16(27-28(7,8)21(2,3)4)18(20(24)26-6)17(14)19(23)25-5/h9,12-14,16-18H,1,10-11H2,2-8H3/t14-,16-,17-,18-/m0/s1 |
| InChIKey | DRJGSJQOBITIFA-DKIMLUQUSA-N |
| XLogP | 3.68 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|