C6F13NO3S — CID 11811714
1,1,2,2-tetrafluoro-2-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)ethanesulfonyl fluoride (PubChem CID 11811714) has the molecular formula C6F13NO3S and a molecular weight of 413.11 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-2-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)ethanesulfonyl fluoride.
| Compound Name | 1,1,2,2-tetrafluoro-2-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)ethanesulfonyl fluoride |
|---|---|
| PubChem CID | 11811714 |
| Molecular Formula | C6F13NO3S |
| Molecular Weight | 413.11 g/mol |
| Exact Mass | 412.94 |
| IUPAC Name | 1,1,2,2-tetrafluoro-2-(2,2,3,3,5,5,6,6-octafluoromorpholin-4-yl)ethanesulfonyl fluoride |
| SMILES | O=S(=O)(F)C(F)(F)C(F)(F)N1C(F)(F)C(F)(F)OC(F)(F)C1(F)F |
| InChI | InChI=1S/C6F13NO3S/c7-1(8)4(13,14)23-5(15,16)2(9,10)20(1)3(11,12)6(17,18)24(19,21)22 |
| InChIKey | DJSJDKURMONFES-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.11 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|