C22H18F3NO4 — CID 11811797
3-O-methyl 1-O-phenyl 6-methyl-4-[(2,3,5-trifluorophenyl)methyl]-4H-pyridine-1,3-dicarboxylate (PubChem CID 11811797) has the molecular formula C22H18F3NO4 and a molecular weight of 417.38 g/mol. Its IUPAC name is 3-O-methyl 1-O-phenyl 6-methyl-4-[(2,3,5-trifluorophenyl)methyl]-4H-pyridine-1,3-dicarboxylate.
| Compound Name | 3-O-methyl 1-O-phenyl 6-methyl-4-[(2,3,5-trifluorophenyl)methyl]-4H-pyridine-1,3-dicarboxylate |
|---|---|
| PubChem CID | 11811797 |
| Molecular Formula | C22H18F3NO4 |
| Molecular Weight | 417.38 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 3-O-methyl 1-O-phenyl 6-methyl-4-[(2,3,5-trifluorophenyl)methyl]-4H-pyridine-1,3-dicarboxylate |
| SMILES | COC(=O)C1=CN(C(=O)Oc2ccccc2)C(C)=CC1Cc1cc(F)cc(F)c1F |
| InChI | InChI=1S/C22H18F3NO4/c1-13-8-14(9-15-10-16(23)11-19(24)20(15)25)18(21(27)29-2)12-26(13)22(28)30-17-6-4-3-5-7-17/h3-8,10-12,14H,9H2,1-2H3 |
| InChIKey | RQKBWQAWFZBVCF-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.38 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|