C28H25F3N6O4 — CID 118118392
2-(6-methylidene-2-oxopiperidin-3-yl)-4-[[4-[[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methyl]phenyl]methoxy]isoindole-1,3-dione (PubChem CID 118118392) has the molecular formula C28H25F3N6O4 and a molecular weight of 566.54 g/mol. Its IUPAC name is 2-(6-methylidene-2-oxopiperidin-3-yl)-4-[[4-[[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methyl]phenyl]methoxy]isoindole-1,3-dione.
| Compound Name | 2-(6-methylidene-2-oxopiperidin-3-yl)-4-[[4-[[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methyl]phenyl]methoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 118118392 |
| Molecular Formula | C28H25F3N6O4 |
| Molecular Weight | 566.54 g/mol |
| Exact Mass | 566.19 |
| IUPAC Name | 2-(6-methylidene-2-oxopiperidin-3-yl)-4-[[4-[[3-(trifluoromethyl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]methyl]phenyl]methoxy]isoindole-1,3-dione |
| SMILES | C=C1CCC(N2C(=O)c3cccc(OCc4ccc(CN5CCn6c(nnc6C(F)(F)F)C5)cc4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C28H25F3N6O4/c1-16-5-10-20(24(38)32-16)37-25(39)19-3-2-4-21(23(19)26(37)40)41-15-18-8-6-17(7-9-18)13-35-11-12-36-22(14-35)33-34-27(36)28(29,30)31/h2-4,6-9,20H,1,5,10-15H2,(H,32,38) |
| InChIKey | DRIINZANUZAPOK-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 109.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.54 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|