C20H36O9 — CID 11811856
(3R,4R,5R)-3,4,5-tris(2-methoxyethoxymethoxy)oct-1-en-7-yne (PubChem CID 11811856) has the molecular formula C20H36O9 and a molecular weight of 420.50 g/mol. Its IUPAC name is (3R,4R,5R)-3,4,5-tris(2-methoxyethoxymethoxy)oct-1-en-7-yne.
| Compound Name | (3R,4R,5R)-3,4,5-tris(2-methoxyethoxymethoxy)oct-1-en-7-yne |
|---|---|
| PubChem CID | 11811856 |
| Molecular Formula | C20H36O9 |
| Molecular Weight | 420.50 g/mol |
| Exact Mass | 420.24 |
| IUPAC Name | (3R,4R,5R)-3,4,5-tris(2-methoxyethoxymethoxy)oct-1-en-7-yne |
| SMILES | C#CC[C@@H](OCOCCOC)[C@@H](OCOCCOC)[C@@H](C=C)OCOCCOC |
| InChI | InChI=1S/C20H36O9/c1-6-8-19(28-16-25-13-10-22-4)20(29-17-26-14-11-23-5)18(7-2)27-15-24-12-9-21-3/h1,7,18-20H,2,8-17H2,3-5H3/t18-,19-,20+/m1/s1 |
| InChIKey | MZSCLTBUOUEUHQ-AQNXPRMDSA-N |
| XLogP | 1.21 |
| TPSA | 83.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.50 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|