C5H9FO3S — CID 118119140
(3S,4S,5R)-3-fluoro-5-(hydroxymethyl)thiolane-2,4-diol (PubChem CID 118119140) has the molecular formula C5H9FO3S and a molecular weight of 168.19 g/mol. Its IUPAC name is (3S,4S,5R)-3-fluoro-5-(hydroxymethyl)thiolane-2,4-diol.
| Compound Name | (3S,4S,5R)-3-fluoro-5-(hydroxymethyl)thiolane-2,4-diol |
|---|---|
| PubChem CID | 118119140 |
| Molecular Formula | C5H9FO3S |
| Molecular Weight | 168.19 g/mol |
| Exact Mass | 168.03 |
| IUPAC Name | (3S,4S,5R)-3-fluoro-5-(hydroxymethyl)thiolane-2,4-diol |
| SMILES | OC[C@H]1SC(O)[C@@H](F)[C@@H]1O |
| InChI | InChI=1S/C5H9FO3S/c6-3-4(8)2(1-7)10-5(3)9/h2-5,7-9H,1H2/t2-,3+,4-,5?/m1/s1 |
| InChIKey | VJOJBWXANVDCFD-IOVATXLUSA-N |
| XLogP | -0.89 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.19 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |