C16H16O2S — CID 118119184
5-methyl-7-phenylmethoxy-1,3-dihydro-2-benzothiophen-1-ol (PubChem CID 118119184) has the molecular formula C16H16O2S and a molecular weight of 272.37 g/mol. Its IUPAC name is 5-methyl-7-phenylmethoxy-1,3-dihydro-2-benzothiophen-1-ol.
| Compound Name | 5-methyl-7-phenylmethoxy-1,3-dihydro-2-benzothiophen-1-ol |
|---|---|
| PubChem CID | 118119184 |
| Molecular Formula | C16H16O2S |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 5-methyl-7-phenylmethoxy-1,3-dihydro-2-benzothiophen-1-ol |
| SMILES | Cc1cc2c(c(OCc3ccccc3)c1)C(O)SC2 |
| InChI | InChI=1S/C16H16O2S/c1-11-7-13-10-19-16(17)15(13)14(8-11)18-9-12-5-3-2-4-6-12/h2-8,16-17H,9-10H2,1H3 |
| InChIKey | KXADQOCLJKBTSG-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |