About 5-deuteriooxybenzene-1,3-diol
5-deuteriooxybenzene-1,3-diol (PubChem CID 118119275) has the molecular formula C6H6O3
and a molecular weight of 127.12 g/mol. Its IUPAC name is 5-deuteriooxybenzene-1,3-diol.
Molecular Properties
| Compound Name | 5-deuteriooxybenzene-1,3-diol |
| PubChem CID | 118119275 |
| Molecular Formula | C6H6O3 |
| Molecular Weight | 127.12 g/mol |
| Exact Mass | 127.04 |
| IUPAC Name | 5-deuteriooxybenzene-1,3-diol |
| SMILES | [2H]Oc1cc(O)cc(O)c1 |
| InChI | InChI=1S/C6H6O3/c7-4-1-5(8)3-6(9)2-4/h1-3,7-9H/i/hD |
| InChIKey | QCDYQQDYXPDABM-DYCDLGHISA-N |
| XLogP | 0.80 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 127.12 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-deuteriooxybenzene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-deuteriooxybenzene-1,3-diol?
The IUPAC name of 5-deuteriooxybenzene-1,3-diol (CID 118119275) is 5-deuteriooxybenzene-1,3-diol.
What is the SMILES notation for 5-deuteriooxybenzene-1,3-diol?
The canonical SMILES for 5-deuteriooxybenzene-1,3-diol is [2H]Oc1cc(O)cc(O)c1.
What is the InChIKey of 5-deuteriooxybenzene-1,3-diol?
The InChIKey is QCDYQQDYXPDABM-DYCDLGHISA-N. The full InChI is InChI=1S/C6H6O3/c7-4-1-5(8)3-6(9)2-4/h1-3,7-9H/i/hD.
What are the key properties of 5-deuteriooxybenzene-1,3-diol?
5-deuteriooxybenzene-1,3-diol has a molecular weight of 127.12 g/mol, XLogP of 0.80, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-deuteriooxybenzene-1,3-diol is sourced from PubChem (CID 118119275), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).