C11H15FO8S — CID 118119336
[(2R,3S,4S)-5-acetyloxy-4-fluoro-3-(2-hydroxyacetyl)oxythiolan-2-yl]methyl 2-hydroxyacetate (PubChem CID 118119336) has the molecular formula C11H15FO8S and a molecular weight of 326.30 g/mol. Its IUPAC name is [(2R,3S,4S)-5-acetyloxy-4-fluoro-3-(2-hydroxyacetyl)oxythiolan-2-yl]methyl 2-hydroxyacetate.
| Compound Name | [(2R,3S,4S)-5-acetyloxy-4-fluoro-3-(2-hydroxyacetyl)oxythiolan-2-yl]methyl 2-hydroxyacetate |
|---|---|
| PubChem CID | 118119336 |
| Molecular Formula | C11H15FO8S |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | [(2R,3S,4S)-5-acetyloxy-4-fluoro-3-(2-hydroxyacetyl)oxythiolan-2-yl]methyl 2-hydroxyacetate |
| SMILES | CC(=O)OC1S[C@H](COC(=O)CO)[C@@H](OC(=O)CO)[C@@H]1F |
| InChI | InChI=1S/C11H15FO8S/c1-5(15)19-11-9(12)10(20-8(17)3-14)6(21-11)4-18-7(16)2-13/h6,9-11,13-14H,2-4H2,1H3/t6-,9+,10-,11?/m1/s1 |
| InChIKey | SOXUOTDFTGOZIA-HXZOXPKISA-N |
| XLogP | -1.23 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|