C14H12F2N2 — CID 118119443
11,13-difluoro-1,7-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-3,5,8,10(15),13-pentaene (PubChem CID 118119443) has the molecular formula C14H12F2N2 and a molecular weight of 246.26 g/mol. Its IUPAC name is 11,13-difluoro-1,7-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-3,5,8,10(15),13-pentaene.
| Compound Name | 11,13-difluoro-1,7-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-3,5,8,10(15),13-pentaene |
|---|---|
| PubChem CID | 118119443 |
| Molecular Formula | C14H12F2N2 |
| Molecular Weight | 246.26 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 11,13-difluoro-1,7-diazatetracyclo[7.7.0.02,7.010,15]hexadeca-3,5,8,10(15),13-pentaene |
| SMILES | FC1=CC2=C(C3=CN4C=CC=CC4N3C2)C(F)C1 |
| InChI | InChI=1S/C14H12F2N2/c15-10-5-9-7-18-12(14(9)11(16)6-10)8-17-4-2-1-3-13(17)18/h1-5,8,11,13H,6-7H2 |
| InChIKey | QQERXTYQVWMCNS-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.26 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |