C22H25ClF3N3O2 — CID 118119501
3-chloro-N-(cyclohexa-1,5-dien-1-ylmethyl)-4-[(3-formamidopiperidin-1-yl)methyl]-5-(trifluoromethyl)benzamide (PubChem CID 118119501) has the molecular formula C22H25ClF3N3O2 and a molecular weight of 455.91 g/mol. Its IUPAC name is 3-chloro-N-(cyclohexa-1,5-dien-1-ylmethyl)-4-[(3-formamidopiperidin-1-yl)methyl]-5-(trifluoromethyl)benzamide.
| Compound Name | 3-chloro-N-(cyclohexa-1,5-dien-1-ylmethyl)-4-[(3-formamidopiperidin-1-yl)methyl]-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 118119501 |
| Molecular Formula | C22H25ClF3N3O2 |
| Molecular Weight | 455.91 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | 3-chloro-N-(cyclohexa-1,5-dien-1-ylmethyl)-4-[(3-formamidopiperidin-1-yl)methyl]-5-(trifluoromethyl)benzamide |
| SMILES | O=CNC1CCCN(Cc2c(Cl)cc(C(=O)NCC3=CCCC=C3)cc2C(F)(F)F)C1 |
| InChI | InChI=1S/C22H25ClF3N3O2/c23-20-10-16(21(31)27-11-15-5-2-1-3-6-15)9-19(22(24,25)26)18(20)13-29-8-4-7-17(12-29)28-14-30/h2,5-6,9-10,14,17H,1,3-4,7-8,11-13H2,(H,27,31)(H,28,30) |
| InChIKey | KQTQVKVUEMOTKE-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.91 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|