About (2S)-2-amino-3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]propanoic acid
(2S)-2-amino-3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]propanoic acid (PubChem CID 11811969) has the molecular formula C21H39NO4Si2
and a molecular weight of 425.72 g/mol. Its IUPAC name is (2S)-2-amino-3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]propanoic acid.
Molecular Properties
| Compound Name | (2S)-2-amino-3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]propanoic acid |
| PubChem CID | 11811969 |
| Molecular Formula | C21H39NO4Si2 |
| Molecular Weight | 425.72 g/mol |
| Exact Mass | 425.24 |
| IUPAC Name | (2S)-2-amino-3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]propanoic acid |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc(C[C@H](N)C(=O)O)cc1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C21H39NO4Si2/c1-20(2,3)27(7,8)25-17-12-11-15(13-16(22)19(23)24)14-18(17)26-28(9,10)21(4,5)6/h11-12,14,16H,13,22H2,1-10H3,(H,23,24)/t16-/m0/s1 |
| InChIKey | ZKVCFGDFWKZKAS-INIZCTEOSA-N |
| XLogP | 5.41 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.72 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-amino-3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]propanoic acid?
The IUPAC name of (2S)-2-amino-3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]propanoic acid (CID 11811969) is (2S)-2-amino-3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]propanoic acid.
What is the SMILES notation for (2S)-2-amino-3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]propanoic acid?
The canonical SMILES for (2S)-2-amino-3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]propanoic acid is CC(C)(C)[Si](C)(C)Oc1ccc(C[C@H](N)C(=O)O)cc1O[Si](C)(C)C(C)(C)C.
What is the InChIKey of (2S)-2-amino-3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]propanoic acid?
The InChIKey is ZKVCFGDFWKZKAS-INIZCTEOSA-N. The full InChI is InChI=1S/C21H39NO4Si2/c1-20(2,3)27(7,8)25-17-12-11-15(13-16(22)19(23)24)14-18(17)26-28(9,10)21(4,5)6/h11-12,14,16H,13,22H2,1-10H3,(H,23,24)/t16-/m0/s1.
What are the key properties of (2S)-2-amino-3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]propanoic acid?
(2S)-2-amino-3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]propanoic acid has a molecular weight of 425.72 g/mol, XLogP of 5.41, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-3-[3,4-bis[[tert-butyl(dimethyl)silyl]oxy]phenyl]propanoic acid is sourced from PubChem (CID 11811969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).