C25H25F3N4O2 — CID 118119835
N-[5-methyl-1-[(1R,3R)-3-(prop-2-enoylamino)cyclohexyl]benzimidazol-2-yl]-3-(trifluoromethyl)benzamide (PubChem CID 118119835) has the molecular formula C25H25F3N4O2 and a molecular weight of 470.50 g/mol. Its IUPAC name is N-[5-methyl-1-[(1R,3R)-3-(prop-2-enoylamino)cyclohexyl]benzimidazol-2-yl]-3-(trifluoromethyl)benzamide.
| Compound Name | N-[5-methyl-1-[(1R,3R)-3-(prop-2-enoylamino)cyclohexyl]benzimidazol-2-yl]-3-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 118119835 |
| Molecular Formula | C25H25F3N4O2 |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.19 |
| IUPAC Name | N-[5-methyl-1-[(1R,3R)-3-(prop-2-enoylamino)cyclohexyl]benzimidazol-2-yl]-3-(trifluoromethyl)benzamide |
| SMILES | C=CC(=O)N[C@@H]1CCC[C@@H](n2c(NC(=O)c3cccc(C(F)(F)F)c3)nc3cc(C)ccc32)C1 |
| InChI | InChI=1S/C25H25F3N4O2/c1-3-22(33)29-18-8-5-9-19(14-18)32-21-11-10-15(2)12-20(21)30-24(32)31-23(34)16-6-4-7-17(13-16)25(26,27)28/h3-4,6-7,10-13,18-19H,1,5,8-9,14H2,2H3,(H,29,33)(H,30,31,34)/t18-,19-/m1/s1 |
| InChIKey | JFCPIPVOYQAKKQ-RTBURBONSA-N |
| XLogP | 5.40 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|