About [(3R)-4-methylmorpholin-3-yl]methyl (2S)-2-aminobutanoate
[(3R)-4-methylmorpholin-3-yl]methyl (2S)-2-aminobutanoate (PubChem CID 118119859) has the molecular formula C10H20N2O3
and a molecular weight of 216.28 g/mol. Its IUPAC name is [(3R)-4-methylmorpholin-3-yl]methyl (2S)-2-aminobutanoate.
Molecular Properties
| Compound Name | [(3R)-4-methylmorpholin-3-yl]methyl (2S)-2-aminobutanoate |
| PubChem CID | 118119859 |
| Molecular Formula | C10H20N2O3 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | [(3R)-4-methylmorpholin-3-yl]methyl (2S)-2-aminobutanoate |
| SMILES | CC[C@H](N)C(=O)OC[C@H]1COCCN1C |
| InChI | InChI=1S/C10H20N2O3/c1-3-9(11)10(13)15-7-8-6-14-5-4-12(8)2/h8-9H,3-7,11H2,1-2H3/t8-,9+/m1/s1 |
| InChIKey | IYOHOHVIHXUUJB-BDAKNGLRSA-N |
| XLogP | -0.40 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [(3R)-4-methylmorpholin-3-yl]methyl (2S)-2-aminobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R)-4-methylmorpholin-3-yl]methyl (2S)-2-aminobutanoate?
The IUPAC name of [(3R)-4-methylmorpholin-3-yl]methyl (2S)-2-aminobutanoate (CID 118119859) is [(3R)-4-methylmorpholin-3-yl]methyl (2S)-2-aminobutanoate.
What is the SMILES notation for [(3R)-4-methylmorpholin-3-yl]methyl (2S)-2-aminobutanoate?
The canonical SMILES for [(3R)-4-methylmorpholin-3-yl]methyl (2S)-2-aminobutanoate is CC[C@H](N)C(=O)OC[C@H]1COCCN1C.
What is the InChIKey of [(3R)-4-methylmorpholin-3-yl]methyl (2S)-2-aminobutanoate?
The InChIKey is IYOHOHVIHXUUJB-BDAKNGLRSA-N. The full InChI is InChI=1S/C10H20N2O3/c1-3-9(11)10(13)15-7-8-6-14-5-4-12(8)2/h8-9H,3-7,11H2,1-2H3/t8-,9+/m1/s1.
What are the key properties of [(3R)-4-methylmorpholin-3-yl]methyl (2S)-2-aminobutanoate?
[(3R)-4-methylmorpholin-3-yl]methyl (2S)-2-aminobutanoate has a molecular weight of 216.28 g/mol, XLogP of -0.40, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R)-4-methylmorpholin-3-yl]methyl (2S)-2-aminobutanoate is sourced from PubChem (CID 118119859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).