C14H10Br4N6O8 — CID 118119990
3,4,5,6-tetrabromo-1,2-bis(2-carbonazidoyloxyethyl)cyclohexa-3,5-diene-1,2-dicarboxylic acid (PubChem CID 118119990) has the molecular formula C14H10Br4N6O8 and a molecular weight of 709.88 g/mol. Its IUPAC name is 3,4,5,6-tetrabromo-1,2-bis(2-carbonazidoyloxyethyl)cyclohexa-3,5-diene-1,2-dicarboxylic acid.
| Compound Name | 3,4,5,6-tetrabromo-1,2-bis(2-carbonazidoyloxyethyl)cyclohexa-3,5-diene-1,2-dicarboxylic acid |
|---|---|
| PubChem CID | 118119990 |
| Molecular Formula | C14H10Br4N6O8 |
| Molecular Weight | 709.88 g/mol |
| Exact Mass | 705.73 |
| IUPAC Name | 3,4,5,6-tetrabromo-1,2-bis(2-carbonazidoyloxyethyl)cyclohexa-3,5-diene-1,2-dicarboxylic acid |
| SMILES | [N-]=[N+]=NC(=O)OCCC1(C(=O)O)C(Br)=C(Br)C(Br)=C(Br)C1(CCOC(=O)N=[N+]=[N-])C(=O)O |
| InChI | InChI=1S/C14H10Br4N6O8/c15-5-6(16)8(18)14(10(27)28,2-4-32-12(30)22-24-20)13(7(5)17,9(25)26)1-3-31-11(29)21-23-19/h1-4H2,(H,25,26)(H,27,28) |
| InChIKey | XJRCQRZCROUBIG-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 224.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.88 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|