C12H26OS — CID 118120015
(3R)-3-ethylsulfanyl-5-methoxy-3,5-dimethylheptane (PubChem CID 118120015) has the molecular formula C12H26OS and a molecular weight of 218.41 g/mol. Its IUPAC name is (3R)-3-ethylsulfanyl-5-methoxy-3,5-dimethylheptane.
| Compound Name | (3R)-3-ethylsulfanyl-5-methoxy-3,5-dimethylheptane |
|---|---|
| PubChem CID | 118120015 |
| Molecular Formula | C12H26OS |
| Molecular Weight | 218.41 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | (3R)-3-ethylsulfanyl-5-methoxy-3,5-dimethylheptane |
| SMILES | CCS[C@](C)(CC)CC(C)(CC)OC |
| InChI | InChI=1S/C12H26OS/c1-7-11(4,13-6)10-12(5,8-2)14-9-3/h7-10H2,1-6H3/t11?,12-/m1/s1 |
| InChIKey | UICOBOYTXCAIMC-PIJUOVFKSA-N |
| XLogP | 4.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.41 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |