About [3-(3,5-dimethylphenoxy)-4-oxochromen-7-yl] pyridine-3-carboxylate
[3-(3,5-dimethylphenoxy)-4-oxochromen-7-yl] pyridine-3-carboxylate (PubChem CID 1181201) has the molecular formula C23H17NO5
and a molecular weight of 387.39 g/mol. Its IUPAC name is [3-(3,5-dimethylphenoxy)-4-oxochromen-7-yl] pyridine-3-carboxylate.
Molecular Properties
| Compound Name | [3-(3,5-dimethylphenoxy)-4-oxochromen-7-yl] pyridine-3-carboxylate |
| PubChem CID | 1181201 |
| Molecular Formula | C23H17NO5 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | [3-(3,5-dimethylphenoxy)-4-oxochromen-7-yl] pyridine-3-carboxylate |
| SMILES | Cc1cc(C)cc(Oc2coc3cc(OC(=O)c4cccnc4)ccc3c2=O)c1 |
| InChI | InChI=1S/C23H17NO5/c1-14-8-15(2)10-18(9-14)28-21-13-27-20-11-17(5-6-19(20)22(21)25)29-23(26)16-4-3-7-24-12-16/h3-13H,1-2H3 |
| InChIKey | XNLVCNUZHVACPF-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [3-(3,5-dimethylphenoxy)-4-oxochromen-7-yl] pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(3,5-dimethylphenoxy)-4-oxochromen-7-yl] pyridine-3-carboxylate?
The IUPAC name of [3-(3,5-dimethylphenoxy)-4-oxochromen-7-yl] pyridine-3-carboxylate (CID 1181201) is [3-(3,5-dimethylphenoxy)-4-oxochromen-7-yl] pyridine-3-carboxylate.
What is the SMILES notation for [3-(3,5-dimethylphenoxy)-4-oxochromen-7-yl] pyridine-3-carboxylate?
The canonical SMILES for [3-(3,5-dimethylphenoxy)-4-oxochromen-7-yl] pyridine-3-carboxylate is Cc1cc(C)cc(Oc2coc3cc(OC(=O)c4cccnc4)ccc3c2=O)c1.
What is the InChIKey of [3-(3,5-dimethylphenoxy)-4-oxochromen-7-yl] pyridine-3-carboxylate?
The InChIKey is XNLVCNUZHVACPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17NO5/c1-14-8-15(2)10-18(9-14)28-21-13-27-20-11-17(5-6-19(20)22(21)25)29-23(26)16-4-3-7-24-12-16/h3-13H,1-2H3.
What are the key properties of [3-(3,5-dimethylphenoxy)-4-oxochromen-7-yl] pyridine-3-carboxylate?
[3-(3,5-dimethylphenoxy)-4-oxochromen-7-yl] pyridine-3-carboxylate has a molecular weight of 387.39 g/mol, XLogP of 4.82, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(3,5-dimethylphenoxy)-4-oxochromen-7-yl] pyridine-3-carboxylate is sourced from PubChem (CID 1181201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).