C9H4Cl2F6O3S — CID 118120527
[1-(3,5-dichlorophenyl)-2,2,2-trifluoroethyl] trifluoromethanesulfonate (PubChem CID 118120527) has the molecular formula C9H4Cl2F6O3S and a molecular weight of 377.09 g/mol. Its IUPAC name is [1-(3,5-dichlorophenyl)-2,2,2-trifluoroethyl] trifluoromethanesulfonate.
| Compound Name | [1-(3,5-dichlorophenyl)-2,2,2-trifluoroethyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 118120527 |
| Molecular Formula | C9H4Cl2F6O3S |
| Molecular Weight | 377.09 g/mol |
| Exact Mass | 375.92 |
| IUPAC Name | [1-(3,5-dichlorophenyl)-2,2,2-trifluoroethyl] trifluoromethanesulfonate |
| SMILES | O=S(=O)(OC(c1cc(Cl)cc(Cl)c1)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H4Cl2F6O3S/c10-5-1-4(2-6(11)3-5)7(8(12,13)14)20-21(18,19)9(15,16)17/h1-3,7H |
| InChIKey | UESBTRXYCNYNBS-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.09 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|