C17H20ClF4NO3 — CID 118120726
tert-butyl 4-[3-chloro-2-fluoro-5-(trifluoromethyl)phenoxy]piperidine-1-carboxylate (PubChem CID 118120726) has the molecular formula C17H20ClF4NO3 and a molecular weight of 397.80 g/mol. Its IUPAC name is tert-butyl 4-[3-chloro-2-fluoro-5-(trifluoromethyl)phenoxy]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-chloro-2-fluoro-5-(trifluoromethyl)phenoxy]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 118120726 |
| Molecular Formula | C17H20ClF4NO3 |
| Molecular Weight | 397.80 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | tert-butyl 4-[3-chloro-2-fluoro-5-(trifluoromethyl)phenoxy]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(Oc2cc(C(F)(F)F)cc(Cl)c2F)CC1 |
| InChI | InChI=1S/C17H20ClF4NO3/c1-16(2,3)26-15(24)23-6-4-11(5-7-23)25-13-9-10(17(20,21)22)8-12(18)14(13)19/h8-9,11H,4-7H2,1-3H3 |
| InChIKey | XPZDFZFOBPCUAA-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.80 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |